Problem: What is the expression for Kp for the reaction below? 4CuO (s) + CH4 (g) ⇌ CO2 (g) + 4Cu (s) + 2H2O (g). a. Kp = [CuO]4[CH4][CO2][Cu]4[H2O]2b. Kp = [CH4][CO2][H2O]2c. Kp = [CO2][Cu]4[H2O]2[CuO]4[CH4]d. Kp = [CO2][H2O]2[CH4] e. Kp = [CO2][H2O][CH4] 

🤓 Based on our data, we think this question is relevant for Professor Marzal's class at UCF.

FREE Expert Solution

Setup the Kp expression for the reaction and determine which is the correct one for the reaction:

4CuO (s) + CH4 (g) ⇌ CO2 (g) + 4Cu (s) + 2H2O (g)

Kp is the equilibrium expression of the concentrations in the reaction. The general form of an equilibrium expression is:

View Complete Written Solution
Problem Details

What is the expression for Kp for the reaction below? 4CuO (s) + CH4 (g) ⇌ CO2 (g) + 4Cu (s) + 2H2O (g)

. a. Kp = [CuO]4[CH4][CO2][Cu]4[H2O]2b. Kp = [CH4][CO2][H2O]2c. Kp = [CO2][Cu]4[H2O]2[CuO]4[CH4]d. Kp = [CO2][H2O]2[CH4] e. Kp = [CO2][H2O][CH4]